C33H33N3O6S — CID 164611328
phenyl (E,3S)-3-[[(2S)-3-(4-methylphenyl)-2-[(1-oxidopyridin-1-ium-4-carbonyl)amino]propanoyl]amino]-5-phenylpent-1-ene-1-sulfonate (PubChem CID 164611328) has the molecular formula C33H33N3O6S and a molecular weight of 599.71 g/mol. Its IUPAC name is phenyl (E,3S)-3-[[(2S)-3-(4-methylphenyl)-2-[(1-oxidopyridin-1-ium-4-carbonyl)amino]propanoyl]amino]-5-phenylpent-1-ene-1-sulfonate.
| Compound Name | phenyl (E,3S)-3-[[(2S)-3-(4-methylphenyl)-2-[(1-oxidopyridin-1-ium-4-carbonyl)amino]propanoyl]amino]-5-phenylpent-1-ene-1-sulfonate |
|---|---|
| PubChem CID | 164611328 |
| Molecular Formula | C33H33N3O6S |
| Molecular Weight | 599.71 g/mol |
| Exact Mass | 599.21 |
| IUPAC Name | phenyl (E,3S)-3-[[(2S)-3-(4-methylphenyl)-2-[(1-oxidopyridin-1-ium-4-carbonyl)amino]propanoyl]amino]-5-phenylpent-1-ene-1-sulfonate |
| SMILES | Cc1ccc(C[C@H](NC(=O)c2cc[n+]([O-])cc2)C(=O)N[C@H](/C=C/S(=O)(=O)Oc2ccccc2)CCc2ccccc2)cc1 |
| InChI | InChI=1S/C33H33N3O6S/c1-25-12-14-27(15-13-25)24-31(35-32(37)28-18-21-36(39)22-19-28)33(38)34-29(17-16-26-8-4-2-5-9-26)20-23-43(40,41)42-30-10-6-3-7-11-30/h2-15,18-23,29,31H,16-17,24H2,1H3,(H,34,38)(H,35,37)/b23-20+/t29-,31-/m0/s1 |
| InChIKey | UXBOFZDGJIYVHK-KOUGTPQRSA-N |
| XLogP | 4.01 |
| TPSA | 128.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.71 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|