C25H25Cl2NO2 — CID 164611414
(1R,4S)-4-(3,4-dichlorophenyl)-N-[(3,4-dimethoxyphenyl)methyl]-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 164611414) has the molecular formula C25H25Cl2NO2 and a molecular weight of 442.39 g/mol. Its IUPAC name is (1R,4S)-4-(3,4-dichlorophenyl)-N-[(3,4-dimethoxyphenyl)methyl]-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | (1R,4S)-4-(3,4-dichlorophenyl)-N-[(3,4-dimethoxyphenyl)methyl]-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 164611414 |
| Molecular Formula | C25H25Cl2NO2 |
| Molecular Weight | 442.39 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | (1R,4S)-4-(3,4-dichlorophenyl)-N-[(3,4-dimethoxyphenyl)methyl]-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | COc1ccc(CN[C@@H]2CC[C@@H](c3ccc(Cl)c(Cl)c3)c3ccccc32)cc1OC |
| InChI | InChI=1S/C25H25Cl2NO2/c1-29-24-12-7-16(13-25(24)30-2)15-28-23-11-9-18(19-5-3-4-6-20(19)23)17-8-10-21(26)22(27)14-17/h3-8,10,12-14,18,23,28H,9,11,15H2,1-2H3/t18-,23+/m0/s1 |
| InChIKey | PIPMHDBGGBOBSD-FDDCHVKYSA-N |
| XLogP | 6.77 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.39 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |