C19H25ClN6OS — CID 164611459
(3S,4S)-8-[6-amino-5-(3-amino-2-chlorophenyl)sulfanylpyrazin-2-yl]-3-methyl-2-oxa-8-azaspiro[4.5]decan-4-amine (PubChem CID 164611459) has the molecular formula C19H25ClN6OS and a molecular weight of 420.97 g/mol. Its IUPAC name is (3S,4S)-8-[6-amino-5-(3-amino-2-chlorophenyl)sulfanylpyrazin-2-yl]-3-methyl-2-oxa-8-azaspiro[4.5]decan-4-amine.
| Compound Name | (3S,4S)-8-[6-amino-5-(3-amino-2-chlorophenyl)sulfanylpyrazin-2-yl]-3-methyl-2-oxa-8-azaspiro[4.5]decan-4-amine |
|---|---|
| PubChem CID | 164611459 |
| Molecular Formula | C19H25ClN6OS |
| Molecular Weight | 420.97 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | (3S,4S)-8-[6-amino-5-(3-amino-2-chlorophenyl)sulfanylpyrazin-2-yl]-3-methyl-2-oxa-8-azaspiro[4.5]decan-4-amine |
| SMILES | C[C@@H]1OCC2(CCN(c3cnc(Sc4cccc(N)c4Cl)c(N)n3)CC2)[C@@H]1N |
| InChI | InChI=1S/C19H25ClN6OS/c1-11-16(22)19(10-27-11)5-7-26(8-6-19)14-9-24-18(17(23)25-14)28-13-4-2-3-12(21)15(13)20/h2-4,9,11,16H,5-8,10,21-22H2,1H3,(H2,23,25)/t11-,16+/m0/s1 |
| InChIKey | KVWGGNAXZPZHJF-MEDUHNTESA-N |
| XLogP | 2.78 |
| TPSA | 116.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.97 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|