C18H14N8O4 — CID 164611641
5-[[4-amino-3-(2-amino-1,3-benzoxazol-5-yl)pyrazolo[3,4-d]pyrimidin-1-yl]methyl]-N-hydroxyfuran-2-carboxamide (PubChem CID 164611641) has the molecular formula C18H14N8O4 and a molecular weight of 406.36 g/mol. Its IUPAC name is 5-[[4-amino-3-(2-amino-1,3-benzoxazol-5-yl)pyrazolo[3,4-d]pyrimidin-1-yl]methyl]-N-hydroxyfuran-2-carboxamide.
| Compound Name | 5-[[4-amino-3-(2-amino-1,3-benzoxazol-5-yl)pyrazolo[3,4-d]pyrimidin-1-yl]methyl]-N-hydroxyfuran-2-carboxamide |
|---|---|
| PubChem CID | 164611641 |
| Molecular Formula | C18H14N8O4 |
| Molecular Weight | 406.36 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | 5-[[4-amino-3-(2-amino-1,3-benzoxazol-5-yl)pyrazolo[3,4-d]pyrimidin-1-yl]methyl]-N-hydroxyfuran-2-carboxamide |
| SMILES | Nc1nc2cc(-c3nn(Cc4ccc(C(=O)NO)o4)c4ncnc(N)c34)ccc2o1 |
| InChI | InChI=1S/C18H14N8O4/c19-15-13-14(8-1-3-11-10(5-8)23-18(20)30-11)24-26(16(13)22-7-21-15)6-9-2-4-12(29-9)17(27)25-28/h1-5,7,28H,6H2,(H2,20,23)(H,25,27)(H2,19,21,22) |
| InChIKey | NASICKBJKLXWFK-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 184.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.36 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|