About 4-(1H-1,2,4-triazol-5-ylsulfanyl)quinazoline
4-(1H-1,2,4-triazol-5-ylsulfanyl)quinazoline (PubChem CID 164611705) has the molecular formula C10H7N5S
and a molecular weight of 229.27 g/mol. Its IUPAC name is 4-(1H-1,2,4-triazol-5-ylsulfanyl)quinazoline.
Molecular Properties
| Compound Name | 4-(1H-1,2,4-triazol-5-ylsulfanyl)quinazoline |
| PubChem CID | 164611705 |
| Molecular Formula | C10H7N5S |
| Molecular Weight | 229.27 g/mol |
| Exact Mass | 229.04 |
| IUPAC Name | 4-(1H-1,2,4-triazol-5-ylsulfanyl)quinazoline |
| SMILES | c1ccc2c(Sc3ncn[nH]3)ncnc2c1 |
| InChI | InChI=1S/C10H7N5S/c1-2-4-8-7(3-1)9(12-5-11-8)16-10-13-6-14-15-10/h1-6H,(H,13,14,15) |
| InChIKey | CITXMJMDSSEKQS-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.27 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(1H-1,2,4-triazol-5-ylsulfanyl)quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1H-1,2,4-triazol-5-ylsulfanyl)quinazoline?
The IUPAC name of 4-(1H-1,2,4-triazol-5-ylsulfanyl)quinazoline (CID 164611705) is 4-(1H-1,2,4-triazol-5-ylsulfanyl)quinazoline.
What is the SMILES notation for 4-(1H-1,2,4-triazol-5-ylsulfanyl)quinazoline?
The canonical SMILES for 4-(1H-1,2,4-triazol-5-ylsulfanyl)quinazoline is c1ccc2c(Sc3ncn[nH]3)ncnc2c1.
What is the InChIKey of 4-(1H-1,2,4-triazol-5-ylsulfanyl)quinazoline?
The InChIKey is CITXMJMDSSEKQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7N5S/c1-2-4-8-7(3-1)9(12-5-11-8)16-10-13-6-14-15-10/h1-6H,(H,13,14,15).
What are the key properties of 4-(1H-1,2,4-triazol-5-ylsulfanyl)quinazoline?
4-(1H-1,2,4-triazol-5-ylsulfanyl)quinazoline has a molecular weight of 229.27 g/mol, XLogP of 1.90, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1H-1,2,4-triazol-5-ylsulfanyl)quinazoline is sourced from PubChem (CID 164611705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).