C24H24F3N5OS — CID 164611710
(2S)-2-(4-butylsulfanylphenyl)-4-(4-methylphenyl)-5-(2H-tetrazol-5-yl)-2-(trifluoromethyl)-1,3-dihydropyridin-6-one (PubChem CID 164611710) has the molecular formula C24H24F3N5OS and a molecular weight of 487.55 g/mol. Its IUPAC name is (2S)-2-(4-butylsulfanylphenyl)-4-(4-methylphenyl)-5-(2H-tetrazol-5-yl)-2-(trifluoromethyl)-1,3-dihydropyridin-6-one.
| Compound Name | (2S)-2-(4-butylsulfanylphenyl)-4-(4-methylphenyl)-5-(2H-tetrazol-5-yl)-2-(trifluoromethyl)-1,3-dihydropyridin-6-one |
|---|---|
| PubChem CID | 164611710 |
| Molecular Formula | C24H24F3N5OS |
| Molecular Weight | 487.55 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | (2S)-2-(4-butylsulfanylphenyl)-4-(4-methylphenyl)-5-(2H-tetrazol-5-yl)-2-(trifluoromethyl)-1,3-dihydropyridin-6-one |
| SMILES | CCCCSc1ccc([C@]2(C(F)(F)F)CC(c3ccc(C)cc3)=C(c3nn[nH]n3)C(=O)N2)cc1 |
| InChI | InChI=1S/C24H24F3N5OS/c1-3-4-13-34-18-11-9-17(10-12-18)23(24(25,26)27)14-19(16-7-5-15(2)6-8-16)20(22(33)28-23)21-29-31-32-30-21/h5-12H,3-4,13-14H2,1-2H3,(H,28,33)(H,29,30,31,32)/t23-/m0/s1 |
| InChIKey | HWZWJXDOSMQTGI-QHCPKHFHSA-N |
| XLogP | 5.29 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.55 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|