C20H30N6OS — CID 164611757
1-[N'-[3-(2-amino-4-methyl-1,3-thiazol-5-yl)propyl]carbamimidoyl]-3-[2-methyl-3-(4-methylphenyl)propyl]urea (PubChem CID 164611757) has the molecular formula C20H30N6OS and a molecular weight of 402.57 g/mol. Its IUPAC name is 1-[N'-[3-(2-amino-4-methyl-1,3-thiazol-5-yl)propyl]carbamimidoyl]-3-[2-methyl-3-(4-methylphenyl)propyl]urea.
| Compound Name | 1-[N'-[3-(2-amino-4-methyl-1,3-thiazol-5-yl)propyl]carbamimidoyl]-3-[2-methyl-3-(4-methylphenyl)propyl]urea |
|---|---|
| PubChem CID | 164611757 |
| Molecular Formula | C20H30N6OS |
| Molecular Weight | 402.57 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | 1-[N'-[3-(2-amino-4-methyl-1,3-thiazol-5-yl)propyl]carbamimidoyl]-3-[2-methyl-3-(4-methylphenyl)propyl]urea |
| SMILES | Cc1ccc(CC(C)CNC(=O)N/C(N)=N/CCCc2sc(N)nc2C)cc1 |
| InChI | InChI=1S/C20H30N6OS/c1-13-6-8-16(9-7-13)11-14(2)12-24-20(27)26-18(21)23-10-4-5-17-15(3)25-19(22)28-17/h6-9,14H,4-5,10-12H2,1-3H3,(H2,22,25)(H4,21,23,24,26,27) |
| InChIKey | BIZMGZSJEDDVNF-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 118.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.57 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|