C28H33F5N4O — CID 164611761
N-[4-[(1R,3R)-2-(2,2-difluoro-3-methoxypropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]-1-(3-fluoropropyl)azetidin-3-amine (PubChem CID 164611761) has the molecular formula C28H33F5N4O and a molecular weight of 536.59 g/mol. Its IUPAC name is N-[4-[(1R,3R)-2-(2,2-difluoro-3-methoxypropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]-1-(3-fluoropropyl)azetidin-3-amine.
| Compound Name | N-[4-[(1R,3R)-2-(2,2-difluoro-3-methoxypropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]-1-(3-fluoropropyl)azetidin-3-amine |
|---|---|
| PubChem CID | 164611761 |
| Molecular Formula | C28H33F5N4O |
| Molecular Weight | 536.59 g/mol |
| Exact Mass | 536.26 |
| IUPAC Name | N-[4-[(1R,3R)-2-(2,2-difluoro-3-methoxypropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]-1-(3-fluoropropyl)azetidin-3-amine |
| SMILES | COCC(F)(F)CN1[C@H](c2c(F)cc(NC3CN(CCCF)C3)cc2F)c2[nH]c3ccccc3c2C[C@H]1C |
| InChI | InChI=1S/C28H33F5N4O/c1-17-10-21-20-6-3-4-7-24(20)35-26(21)27(37(17)15-28(32,33)16-38-2)25-22(30)11-18(12-23(25)31)34-19-13-36(14-19)9-5-8-29/h3-4,6-7,11-12,17,19,27,34-35H,5,8-10,13-16H2,1-2H3/t17-,27-/m1/s1 |
| InChIKey | DNUWTEMWTOXGIK-XGCWNURASA-N |
| XLogP | 5.52 |
| TPSA | 43.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.59 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|