C20H35N — CID 164611765
N-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclopentanamine (PubChem CID 164611765) has the molecular formula C20H35N and a molecular weight of 289.51 g/mol. Its IUPAC name is N-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclopentanamine.
| Compound Name | N-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclopentanamine |
|---|---|
| PubChem CID | 164611765 |
| Molecular Formula | C20H35N |
| Molecular Weight | 289.51 g/mol |
| Exact Mass | 289.28 |
| IUPAC Name | N-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]cyclopentanamine |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CNC1CCCC1 |
| InChI | InChI=1S/C20H35N/c1-17(2)9-7-10-18(3)11-8-12-19(4)15-16-21-20-13-5-6-14-20/h9,11,15,20-21H,5-8,10,12-14,16H2,1-4H3/b18-11+,19-15+ |
| InChIKey | VNIYLCPNHDYGBA-CFBAGHHKSA-N |
| XLogP | 5.94 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.51 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|