C25H30O6 — CID 164611839
[(4S)-4-[(3aR,4S,7S,7aR)-4-acetyloxy-6-methyl-3-methylidene-2-oxo-7-phenyl-3a,4,7,7a-tetrahydro-1-benzofuran-5-yl]pentyl] acetate (PubChem CID 164611839) has the molecular formula C25H30O6 and a molecular weight of 426.51 g/mol. Its IUPAC name is [(4S)-4-[(3aR,4S,7S,7aR)-4-acetyloxy-6-methyl-3-methylidene-2-oxo-7-phenyl-3a,4,7,7a-tetrahydro-1-benzofuran-5-yl]pentyl] acetate.
| Compound Name | [(4S)-4-[(3aR,4S,7S,7aR)-4-acetyloxy-6-methyl-3-methylidene-2-oxo-7-phenyl-3a,4,7,7a-tetrahydro-1-benzofuran-5-yl]pentyl] acetate |
|---|---|
| PubChem CID | 164611839 |
| Molecular Formula | C25H30O6 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | [(4S)-4-[(3aR,4S,7S,7aR)-4-acetyloxy-6-methyl-3-methylidene-2-oxo-7-phenyl-3a,4,7,7a-tetrahydro-1-benzofuran-5-yl]pentyl] acetate |
| SMILES | C=C1C(=O)O[C@H]2[C@@H]1[C@H](OC(C)=O)C([C@@H](C)CCCOC(C)=O)=C(C)[C@@H]2c1ccccc1 |
| InChI | InChI=1S/C25H30O6/c1-14(10-9-13-29-17(4)26)20-15(2)21(19-11-7-6-8-12-19)24-22(16(3)25(28)31-24)23(20)30-18(5)27/h6-8,11-12,14,21-24H,3,9-10,13H2,1-2,4-5H3/t14-,21+,22-,23+,24+/m0/s1 |
| InChIKey | SQECFHPFNALSHZ-KQDUROPFSA-N |
| XLogP | 4.11 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|