C20H19N5O — CID 164611914
(2R)-2-[[6-(3-methyl-2H-indazol-5-yl)pyrazin-2-yl]amino]-2-phenylethanol (PubChem CID 164611914) has the molecular formula C20H19N5O and a molecular weight of 345.41 g/mol. Its IUPAC name is (2R)-2-[[6-(3-methyl-2H-indazol-5-yl)pyrazin-2-yl]amino]-2-phenylethanol.
| Compound Name | (2R)-2-[[6-(3-methyl-2H-indazol-5-yl)pyrazin-2-yl]amino]-2-phenylethanol |
|---|---|
| PubChem CID | 164611914 |
| Molecular Formula | C20H19N5O |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | (2R)-2-[[6-(3-methyl-2H-indazol-5-yl)pyrazin-2-yl]amino]-2-phenylethanol |
| SMILES | Cc1[nH]nc2ccc(-c3cncc(N[C@@H](CO)c4ccccc4)n3)cc12 |
| InChI | InChI=1S/C20H19N5O/c1-13-16-9-15(7-8-17(16)25-24-13)18-10-21-11-20(22-18)23-19(12-26)14-5-3-2-4-6-14/h2-11,19,26H,12H2,1H3,(H,22,23)(H,24,25)/t19-/m0/s1 |
| InChIKey | WQCXLUNOPQPYFK-IBGZPJMESA-N |
| XLogP | 3.47 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |