C27H40O5 — CID 164611940
(2S)-2-methoxy-3-[(2R,6R)-6-methoxy-5-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,6-dihydro-2H-pyran-2-yl]-2H-furan-5-one (PubChem CID 164611940) has the molecular formula C27H40O5 and a molecular weight of 444.61 g/mol. Its IUPAC name is (2S)-2-methoxy-3-[(2R,6R)-6-methoxy-5-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,6-dihydro-2H-pyran-2-yl]-2H-furan-5-one.
| Compound Name | (2S)-2-methoxy-3-[(2R,6R)-6-methoxy-5-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,6-dihydro-2H-pyran-2-yl]-2H-furan-5-one |
|---|---|
| PubChem CID | 164611940 |
| Molecular Formula | C27H40O5 |
| Molecular Weight | 444.61 g/mol |
| Exact Mass | 444.29 |
| IUPAC Name | (2S)-2-methoxy-3-[(2R,6R)-6-methoxy-5-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-3,6-dihydro-2H-pyran-2-yl]-2H-furan-5-one |
| SMILES | CO[C@@H]1O[C@@H](C2=CC(=O)O[C@@H]2OC)CC=C1CC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C27H40O5/c1-19(2)10-7-11-20(3)12-8-13-21(4)14-9-15-22-16-17-24(31-26(22)29-5)23-18-25(28)32-27(23)30-6/h10,12,14,16,18,24,26-27H,7-9,11,13,15,17H2,1-6H3/b20-12+,21-14+/t24-,26-,27+/m1/s1 |
| InChIKey | SGUUZMDLXAECIT-LQVHRBGPSA-N |
| XLogP | 6.33 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.61 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|