About 4-[4-[[2-(2,5-difluorophenyl)-4-pyridinyl]amino]quinolin-7-yl]phenol
4-[4-[[2-(2,5-difluorophenyl)-4-pyridinyl]amino]quinolin-7-yl]phenol (PubChem CID 164611944) has the molecular formula C26H17F2N3O
and a molecular weight of 425.44 g/mol. Its IUPAC name is 4-[4-[[2-(2,5-difluorophenyl)-4-pyridinyl]amino]quinolin-7-yl]phenol.
Molecular Properties
| Compound Name | 4-[4-[[2-(2,5-difluorophenyl)-4-pyridinyl]amino]quinolin-7-yl]phenol |
| PubChem CID | 164611944 |
| Molecular Formula | C26H17F2N3O |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | 4-[4-[[2-(2,5-difluorophenyl)-4-pyridinyl]amino]quinolin-7-yl]phenol |
| SMILES | Oc1ccc(-c2ccc3c(Nc4ccnc(-c5cc(F)ccc5F)c4)ccnc3c2)cc1 |
| InChI | InChI=1S/C26H17F2N3O/c27-18-4-8-23(28)22(14-18)26-15-19(9-11-29-26)31-24-10-12-30-25-13-17(3-7-21(24)25)16-1-5-20(32)6-2-16/h1-15,32H,(H,29,30,31) |
| InChIKey | LZXQSGOKGXBVLB-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[4-[[2-(2,5-difluorophenyl)-4-pyridinyl]amino]quinolin-7-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[[2-(2,5-difluorophenyl)-4-pyridinyl]amino]quinolin-7-yl]phenol?
The IUPAC name of 4-[4-[[2-(2,5-difluorophenyl)-4-pyridinyl]amino]quinolin-7-yl]phenol (CID 164611944) is 4-[4-[[2-(2,5-difluorophenyl)-4-pyridinyl]amino]quinolin-7-yl]phenol.
What is the SMILES notation for 4-[4-[[2-(2,5-difluorophenyl)-4-pyridinyl]amino]quinolin-7-yl]phenol?
The canonical SMILES for 4-[4-[[2-(2,5-difluorophenyl)-4-pyridinyl]amino]quinolin-7-yl]phenol is Oc1ccc(-c2ccc3c(Nc4ccnc(-c5cc(F)ccc5F)c4)ccnc3c2)cc1.
What is the InChIKey of 4-[4-[[2-(2,5-difluorophenyl)-4-pyridinyl]amino]quinolin-7-yl]phenol?
The InChIKey is LZXQSGOKGXBVLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H17F2N3O/c27-18-4-8-23(28)22(14-18)26-15-19(9-11-29-26)31-24-10-12-30-25-13-17(3-7-21(24)25)16-1-5-20(32)6-2-16/h1-15,32H,(H,29,30,31).
What are the key properties of 4-[4-[[2-(2,5-difluorophenyl)-4-pyridinyl]amino]quinolin-7-yl]phenol?
4-[4-[[2-(2,5-difluorophenyl)-4-pyridinyl]amino]quinolin-7-yl]phenol has a molecular weight of 425.44 g/mol, XLogP of 6.69, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[[2-(2,5-difluorophenyl)-4-pyridinyl]amino]quinolin-7-yl]phenol is sourced from PubChem (CID 164611944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).