C37H46F2N5O3+ — CID 164612001
N-(3,5-difluorophenyl)-7-(dimethylamino)-1-[4-methyl-3-[7-(1-methylpiperidin-1-ium-1-yl)heptoxy]phenyl]-4-oxo-1,8-naphthyridine-3-carboxamide (PubChem CID 164612001) has the molecular formula C37H46F2N5O3+ and a molecular weight of 646.80 g/mol. Its IUPAC name is N-(3,5-difluorophenyl)-7-(dimethylamino)-1-[4-methyl-3-[7-(1-methylpiperidin-1-ium-1-yl)heptoxy]phenyl]-4-oxo-1,8-naphthyridine-3-carboxamide.
| Compound Name | N-(3,5-difluorophenyl)-7-(dimethylamino)-1-[4-methyl-3-[7-(1-methylpiperidin-1-ium-1-yl)heptoxy]phenyl]-4-oxo-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 164612001 |
| Molecular Formula | C37H46F2N5O3+ |
| Molecular Weight | 646.80 g/mol |
| Exact Mass | 646.36 |
| IUPAC Name | N-(3,5-difluorophenyl)-7-(dimethylamino)-1-[4-methyl-3-[7-(1-methylpiperidin-1-ium-1-yl)heptoxy]phenyl]-4-oxo-1,8-naphthyridine-3-carboxamide |
| SMILES | Cc1ccc(-n2cc(C(=O)Nc3cc(F)cc(F)c3)c(=O)c3ccc(N(C)C)nc32)cc1OCCCCCCC[N+]1(C)CCCCC1 |
| InChI | InChI=1S/C37H45F2N5O3/c1-26-13-14-30(24-33(26)47-20-12-7-5-6-9-17-44(4)18-10-8-11-19-44)43-25-32(37(46)40-29-22-27(38)21-28(39)23-29)35(45)31-15-16-34(42(2)3)41-36(31)43/h13-16,21-25H,5-12,17-20H2,1-4H3/p+1 |
| InChIKey | WJHGBNMYOAPDKQ-UHFFFAOYSA-O |
| XLogP | 7.25 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.80 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|