C25H31FN4O — CID 164612087
N-(4-fluorophenyl)-1-[1-(2-methylpyrimidin-4-yl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-6-yl]cyclobutane-1-carboxamide (PubChem CID 164612087) has the molecular formula C25H31FN4O and a molecular weight of 422.55 g/mol. Its IUPAC name is N-(4-fluorophenyl)-1-[1-(2-methylpyrimidin-4-yl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-6-yl]cyclobutane-1-carboxamide.
| Compound Name | N-(4-fluorophenyl)-1-[1-(2-methylpyrimidin-4-yl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-6-yl]cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 164612087 |
| Molecular Formula | C25H31FN4O |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | N-(4-fluorophenyl)-1-[1-(2-methylpyrimidin-4-yl)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-6-yl]cyclobutane-1-carboxamide |
| SMILES | Cc1nccc(N2CCCC3CC(C4(C(=O)Nc5ccc(F)cc5)CCC4)CCC32)n1 |
| InChI | InChI=1S/C25H31FN4O/c1-17-27-14-11-23(28-17)30-15-2-4-18-16-19(5-10-22(18)30)25(12-3-13-25)24(31)29-21-8-6-20(26)7-9-21/h6-9,11,14,18-19,22H,2-5,10,12-13,15-16H2,1H3,(H,29,31) |
| InChIKey | XZJKXGOWZFBPDZ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |