About 6-methoxy-1-[(3-methoxy-2-methyl-4-phenylmethoxyphenyl)methyl]-3,4-dihydroisoquinoline
6-methoxy-1-[(3-methoxy-2-methyl-4-phenylmethoxyphenyl)methyl]-3,4-dihydroisoquinoline (PubChem CID 164612102) has the molecular formula C26H27NO3
and a molecular weight of 401.51 g/mol. Its IUPAC name is 6-methoxy-1-[(3-methoxy-2-methyl-4-phenylmethoxyphenyl)methyl]-3,4-dihydroisoquinoline.
Molecular Properties
| Compound Name | 6-methoxy-1-[(3-methoxy-2-methyl-4-phenylmethoxyphenyl)methyl]-3,4-dihydroisoquinoline |
| PubChem CID | 164612102 |
| Molecular Formula | C26H27NO3 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 6-methoxy-1-[(3-methoxy-2-methyl-4-phenylmethoxyphenyl)methyl]-3,4-dihydroisoquinoline |
| SMILES | COc1ccc2c(c1)CCN=C2Cc1ccc(OCc2ccccc2)c(OC)c1C |
| InChI | InChI=1S/C26H27NO3/c1-18-20(16-24-23-11-10-22(28-2)15-21(23)13-14-27-24)9-12-25(26(18)29-3)30-17-19-7-5-4-6-8-19/h4-12,15H,13-14,16-17H2,1-3H3 |
| InChIKey | PYKCQRCJADBTTB-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-methoxy-1-[(3-methoxy-2-methyl-4-phenylmethoxyphenyl)methyl]-3,4-dihydroisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-1-[(3-methoxy-2-methyl-4-phenylmethoxyphenyl)methyl]-3,4-dihydroisoquinoline?
The IUPAC name of 6-methoxy-1-[(3-methoxy-2-methyl-4-phenylmethoxyphenyl)methyl]-3,4-dihydroisoquinoline (CID 164612102) is 6-methoxy-1-[(3-methoxy-2-methyl-4-phenylmethoxyphenyl)methyl]-3,4-dihydroisoquinoline.
What is the SMILES notation for 6-methoxy-1-[(3-methoxy-2-methyl-4-phenylmethoxyphenyl)methyl]-3,4-dihydroisoquinoline?
The canonical SMILES for 6-methoxy-1-[(3-methoxy-2-methyl-4-phenylmethoxyphenyl)methyl]-3,4-dihydroisoquinoline is COc1ccc2c(c1)CCN=C2Cc1ccc(OCc2ccccc2)c(OC)c1C.
What is the InChIKey of 6-methoxy-1-[(3-methoxy-2-methyl-4-phenylmethoxyphenyl)methyl]-3,4-dihydroisoquinoline?
The InChIKey is PYKCQRCJADBTTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H27NO3/c1-18-20(16-24-23-11-10-22(28-2)15-21(23)13-14-27-24)9-12-25(26(18)29-3)30-17-19-7-5-4-6-8-19/h4-12,15H,13-14,16-17H2,1-3H3.
What are the key properties of 6-methoxy-1-[(3-methoxy-2-methyl-4-phenylmethoxyphenyl)methyl]-3,4-dihydroisoquinoline?
6-methoxy-1-[(3-methoxy-2-methyl-4-phenylmethoxyphenyl)methyl]-3,4-dihydroisoquinoline has a molecular weight of 401.51 g/mol, XLogP of 5.18, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-1-[(3-methoxy-2-methyl-4-phenylmethoxyphenyl)methyl]-3,4-dihydroisoquinoline is sourced from PubChem (CID 164612102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).