C22H33N3O2 — CID 164612131
6-[[[(3R,5S)-3,5-dimethyl-1-adamantyl]-propylamino]methyl]-N-hydroxypyridine-3-carboxamide (PubChem CID 164612131) has the molecular formula C22H33N3O2 and a molecular weight of 371.53 g/mol. Its IUPAC name is 6-[[[(3R,5S)-3,5-dimethyl-1-adamantyl]-propylamino]methyl]-N-hydroxypyridine-3-carboxamide.
| Compound Name | 6-[[[(3R,5S)-3,5-dimethyl-1-adamantyl]-propylamino]methyl]-N-hydroxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 164612131 |
| Molecular Formula | C22H33N3O2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | 6-[[[(3R,5S)-3,5-dimethyl-1-adamantyl]-propylamino]methyl]-N-hydroxypyridine-3-carboxamide |
| SMILES | CCCN(Cc1ccc(C(=O)NO)cn1)C12CC3C[C@@](C)(C1)C[C@](C)(C3)C2 |
| InChI | InChI=1S/C22H33N3O2/c1-4-7-25(12-18-6-5-17(11-23-18)19(26)24-27)22-10-16-8-20(2,14-22)13-21(3,9-16)15-22/h5-6,11,16,27H,4,7-10,12-15H2,1-3H3,(H,24,26)/t16?,20-,21+,22? |
| InChIKey | QTOMNVPNGBVDPG-NJMHRBNOSA-N |
| XLogP | 4.16 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|