C18H22N4O3 — CID 164612136
5-methyl-5-[3-oxo-3-(5-phenyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)propyl]imidazolidine-2,4-dione (PubChem CID 164612136) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is 5-methyl-5-[3-oxo-3-(5-phenyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)propyl]imidazolidine-2,4-dione.
| Compound Name | 5-methyl-5-[3-oxo-3-(5-phenyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)propyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 164612136 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 5-methyl-5-[3-oxo-3-(5-phenyl-2,5-diazabicyclo[2.2.1]heptan-2-yl)propyl]imidazolidine-2,4-dione |
| SMILES | CC1(CCC(=O)N2CC3CC2CN3c2ccccc2)NC(=O)NC1=O |
| InChI | InChI=1S/C18H22N4O3/c1-18(16(24)19-17(25)20-18)8-7-15(23)22-11-13-9-14(22)10-21(13)12-5-3-2-4-6-12/h2-6,13-14H,7-11H2,1H3,(H2,19,20,24,25) |
| InChIKey | FVNSHIBSRDNGFJ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|