C16H19N3O — CID 164612169
N'-[3-(2-aminophenyl)-3-hydroxypropyl]benzenecarboximidamide (PubChem CID 164612169) has the molecular formula C16H19N3O and a molecular weight of 269.35 g/mol. Its IUPAC name is N'-[3-(2-aminophenyl)-3-hydroxypropyl]benzenecarboximidamide.
| Compound Name | N'-[3-(2-aminophenyl)-3-hydroxypropyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 164612169 |
| Molecular Formula | C16H19N3O |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | N'-[3-(2-aminophenyl)-3-hydroxypropyl]benzenecarboximidamide |
| SMILES | N/C(=N\CCC(O)c1ccccc1N)c1ccccc1 |
| InChI | InChI=1S/C16H19N3O/c17-14-9-5-4-8-13(14)15(20)10-11-19-16(18)12-6-2-1-3-7-12/h1-9,15,20H,10-11,17H2,(H2,18,19) |
| InChIKey | OJKRZGJRUOAGPO-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 84.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|