C30H30N6O4S — CID 164612460
(12E)-10,15-dioxa-37-thia-2,23,25,26,33,34-hexazapentacyclo[30.2.2.15,9.116,20.124,27]nonatriaconta-1(34),5(39),6,8,12,16,18,20(38),24,26,32,35-dodecaene-3,22-dione (PubChem CID 164612460) has the molecular formula C30H30N6O4S and a molecular weight of 570.68 g/mol. Its IUPAC name is (12E)-10,15-dioxa-37-thia-2,23,25,26,33,34-hexazapentacyclo[30.2.2.15,9.116,20.124,27]nonatriaconta-1(34),5(39),6,8,12,16,18,20(38),24,26,32,35-dodecaene-3,22-dione.
| Compound Name | (12E)-10,15-dioxa-37-thia-2,23,25,26,33,34-hexazapentacyclo[30.2.2.15,9.116,20.124,27]nonatriaconta-1(34),5(39),6,8,12,16,18,20(38),24,26,32,35-dodecaene-3,22-dione |
|---|---|
| PubChem CID | 164612460 |
| Molecular Formula | C30H30N6O4S |
| Molecular Weight | 570.68 g/mol |
| Exact Mass | 570.20 |
| IUPAC Name | (12E)-10,15-dioxa-37-thia-2,23,25,26,33,34-hexazapentacyclo[30.2.2.15,9.116,20.124,27]nonatriaconta-1(34),5(39),6,8,12,16,18,20(38),24,26,32,35-dodecaene-3,22-dione |
| SMILES | O=C1Cc2cccc(c2)OC/C=C/COc2cccc(c2)CC(=O)Nc2nnc(s2)CCCCc2ccc(nn2)N1 |
| InChI | InChI=1S/C30H30N6O4S/c37-27-19-21-7-5-10-24(17-21)39-15-3-4-16-40-25-11-6-8-22(18-25)20-28(38)32-30-36-35-29(41-30)12-2-1-9-23-13-14-26(31-27)34-33-23/h3-8,10-11,13-14,17-18H,1-2,9,12,15-16,19-20H2,(H,31,34,37)(H,32,36,38)/b4-3+ |
| InChIKey | CSVGQKAATSWCOC-ONEGZZNKSA-N |
| XLogP | 4.58 |
| TPSA | 128.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.68 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|