C35H40Cl2N6O3 — CID 164612475
N-[2-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-yl]amino]-3-methyl-5-[2-(3-pyrrolidin-1-ylpropylamino)ethyl]phenyl]prop-2-enamide (PubChem CID 164612475) has the molecular formula C35H40Cl2N6O3 and a molecular weight of 663.65 g/mol. Its IUPAC name is N-[2-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-yl]amino]-3-methyl-5-[2-(3-pyrrolidin-1-ylpropylamino)ethyl]phenyl]prop-2-enamide.
| Compound Name | N-[2-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-yl]amino]-3-methyl-5-[2-(3-pyrrolidin-1-ylpropylamino)ethyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 164612475 |
| Molecular Formula | C35H40Cl2N6O3 |
| Molecular Weight | 663.65 g/mol |
| Exact Mass | 662.25 |
| IUPAC Name | N-[2-[[6-(2,6-dichloro-3,5-dimethoxyphenyl)quinazolin-2-yl]amino]-3-methyl-5-[2-(3-pyrrolidin-1-ylpropylamino)ethyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(CCNCCCN2CCCC2)cc(C)c1Nc1ncc2cc(-c3c(Cl)c(OC)cc(OC)c3Cl)ccc2n1 |
| InChI | InChI=1S/C35H40Cl2N6O3/c1-5-30(44)40-27-18-23(11-13-38-12-8-16-43-14-6-7-15-43)17-22(2)34(27)42-35-39-21-25-19-24(9-10-26(25)41-35)31-32(36)28(45-3)20-29(46-4)33(31)37/h5,9-10,17-21,38H,1,6-8,11-16H2,2-4H3,(H,40,44)(H,39,41,42) |
| InChIKey | TWIYAMYOJBJETQ-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 100.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.65 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|