C27H27F8NO5S2 — CID 164612502
4-[[(3R,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalen-3-yl]amino]-1,1-dioxothian-4-ol (PubChem CID 164612502) has the molecular formula C27H27F8NO5S2 and a molecular weight of 661.63 g/mol. Its IUPAC name is 4-[[(3R,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalen-3-yl]amino]-1,1-dioxothian-4-ol.
| Compound Name | 4-[[(3R,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalen-3-yl]amino]-1,1-dioxothian-4-ol |
|---|---|
| PubChem CID | 164612502 |
| Molecular Formula | C27H27F8NO5S2 |
| Molecular Weight | 661.63 g/mol |
| Exact Mass | 661.12 |
| IUPAC Name | 4-[[(3R,3aS,9bS)-9b-(4-fluorophenyl)sulfonyl-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3,3a,4,5-hexahydrocyclopenta[a]naphthalen-3-yl]amino]-1,1-dioxothian-4-ol |
| SMILES | O=S1(=O)CCC(O)(N[C@@H]2CC[C@@]3(S(=O)(=O)c4ccc(F)cc4)c4ccc(C(F)(C(F)(F)F)C(F)(F)F)cc4CC[C@@H]23)CC1 |
| InChI | InChI=1S/C27H27F8NO5S2/c28-18-3-5-19(6-4-18)43(40,41)24-10-9-22(36-23(37)11-13-42(38,39)14-12-23)21(24)7-1-16-15-17(2-8-20(16)24)25(29,26(30,31)32)27(33,34)35/h2-6,8,15,21-22,36-37H,1,7,9-14H2/t21-,22+,24+/m0/s1 |
| InChIKey | VTOPUMYXPVWTOE-WMTXJRDZSA-N |
| XLogP | 5.00 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.63 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|