C24H36O2 — CID 164612648
3-[(3E,6E,10E)-4,7,11,15-tetramethylhexadeca-3,6,10,14-tetraenyl]-2H-furan-5-one (PubChem CID 164612648) has the molecular formula C24H36O2 and a molecular weight of 356.55 g/mol. Its IUPAC name is 3-[(3E,6E,10E)-4,7,11,15-tetramethylhexadeca-3,6,10,14-tetraenyl]-2H-furan-5-one.
| Compound Name | 3-[(3E,6E,10E)-4,7,11,15-tetramethylhexadeca-3,6,10,14-tetraenyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 164612648 |
| Molecular Formula | C24H36O2 |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 356.27 |
| IUPAC Name | 3-[(3E,6E,10E)-4,7,11,15-tetramethylhexadeca-3,6,10,14-tetraenyl]-2H-furan-5-one |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/C/C(C)=C/CCC1=CC(=O)OC1 |
| InChI | InChI=1S/C24H36O2/c1-19(2)9-6-10-20(3)11-7-12-21(4)15-16-22(5)13-8-14-23-17-24(25)26-18-23/h9,11,13,15,17H,6-8,10,12,14,16,18H2,1-5H3/b20-11+,21-15+,22-13+ |
| InChIKey | XMTOQSPPSPEWHC-WGOVEGMISA-N |
| XLogP | 7.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|