C23H34FN — CID 164612703
(2E,6E)-N-[2-(4-fluorophenyl)ethyl]-3,7,11-trimethyldodeca-2,6,10-trien-1-amine (PubChem CID 164612703) has the molecular formula C23H34FN and a molecular weight of 343.53 g/mol. Its IUPAC name is (2E,6E)-N-[2-(4-fluorophenyl)ethyl]-3,7,11-trimethyldodeca-2,6,10-trien-1-amine.
| Compound Name | (2E,6E)-N-[2-(4-fluorophenyl)ethyl]-3,7,11-trimethyldodeca-2,6,10-trien-1-amine |
|---|---|
| PubChem CID | 164612703 |
| Molecular Formula | C23H34FN |
| Molecular Weight | 343.53 g/mol |
| Exact Mass | 343.27 |
| IUPAC Name | (2E,6E)-N-[2-(4-fluorophenyl)ethyl]-3,7,11-trimethyldodeca-2,6,10-trien-1-amine |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CNCCc1ccc(F)cc1 |
| InChI | InChI=1S/C23H34FN/c1-19(2)7-5-8-20(3)9-6-10-21(4)15-17-25-18-16-22-11-13-23(24)14-12-22/h7,9,11-15,25H,5-6,8,10,16-18H2,1-4H3/b20-9+,21-15+ |
| InChIKey | BXJRIZLAENLUEW-TVGRKTJDSA-N |
| XLogP | 6.38 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.53 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|