C25H34N6O2 — CID 164612861
1-cyclopentyl-7-[4-(4-methylpiperazin-1-yl)anilino]-4-propan-2-yl-4H-pyrimido[4,5-d][1,3]oxazin-2-one (PubChem CID 164612861) has the molecular formula C25H34N6O2 and a molecular weight of 450.59 g/mol. Its IUPAC name is 1-cyclopentyl-7-[4-(4-methylpiperazin-1-yl)anilino]-4-propan-2-yl-4H-pyrimido[4,5-d][1,3]oxazin-2-one.
| Compound Name | 1-cyclopentyl-7-[4-(4-methylpiperazin-1-yl)anilino]-4-propan-2-yl-4H-pyrimido[4,5-d][1,3]oxazin-2-one |
|---|---|
| PubChem CID | 164612861 |
| Molecular Formula | C25H34N6O2 |
| Molecular Weight | 450.59 g/mol |
| Exact Mass | 450.27 |
| IUPAC Name | 1-cyclopentyl-7-[4-(4-methylpiperazin-1-yl)anilino]-4-propan-2-yl-4H-pyrimido[4,5-d][1,3]oxazin-2-one |
| SMILES | CC(C)C1OC(=O)N(C2CCCC2)c2nc(Nc3ccc(N4CCN(C)CC4)cc3)ncc21 |
| InChI | InChI=1S/C25H34N6O2/c1-17(2)22-21-16-26-24(28-23(21)31(25(32)33-22)20-6-4-5-7-20)27-18-8-10-19(11-9-18)30-14-12-29(3)13-15-30/h8-11,16-17,20,22H,4-7,12-15H2,1-3H3,(H,26,27,28) |
| InChIKey | LSVFBVIPBGBAEI-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.59 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|