C19H21N5O2 — CID 164613009
BET-BD2 Inhibitor GSK452 (PubChem CID 164613009) has the molecular formula C19H21N5O2 and a molecular weight of 351.40 g/mol. Its IUPAC name is N-ethyl-4-[(6-methyl-2-pyridinyl)methoxy]-3-(1-methyltriazol-4-yl)benzamide.
| Compound Name | BET-BD2 Inhibitor GSK452 |
|---|---|
| PubChem CID | 164613009 |
| Molecular Formula | C19H21N5O2 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | N-ethyl-4-[(6-methyl-2-pyridinyl)methoxy]-3-(1-methyltriazol-4-yl)benzamide |
| SMILES | CCNC(=O)C1=CC(=C(C=C1)OCC2=CC=CC(=N2)C)C3=CN(N=N3)C |
| InChI | InChI=1S/C19H21N5O2/c1-4-20-19(25)14-8-9-18(16(10-14)17-11-24(3)23-22-17)26-12-15-7-5-6-13(2)21-15/h5-11H,4,12H2,1-3H3,(H,20,25) |
| InChIKey | BHUOTMULUBCHII-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 81.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | 463 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |