C24H23N5O2 — CID 164613078
4-[[2-(3,5-dimethylphenyl)-5-phenyl-1,2,4-triazol-3-yl]methylamino]-N-hydroxybenzamide (PubChem CID 164613078) has the molecular formula C24H23N5O2 and a molecular weight of 413.48 g/mol. Its IUPAC name is 4-[[2-(3,5-dimethylphenyl)-5-phenyl-1,2,4-triazol-3-yl]methylamino]-N-hydroxybenzamide.
| Compound Name | 4-[[2-(3,5-dimethylphenyl)-5-phenyl-1,2,4-triazol-3-yl]methylamino]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 164613078 |
| Molecular Formula | C24H23N5O2 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | 4-[[2-(3,5-dimethylphenyl)-5-phenyl-1,2,4-triazol-3-yl]methylamino]-N-hydroxybenzamide |
| SMILES | Cc1cc(C)cc(-n2nc(-c3ccccc3)nc2CNc2ccc(C(=O)NO)cc2)c1 |
| InChI | InChI=1S/C24H23N5O2/c1-16-12-17(2)14-21(13-16)29-22(26-23(27-29)18-6-4-3-5-7-18)15-25-20-10-8-19(9-11-20)24(30)28-31/h3-14,25,31H,15H2,1-2H3,(H,28,30) |
| InChIKey | MLGCBOAGWQLZHZ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|