C17H22O4 — CID 164613149
[(4S)-4-[(3aR,7aR)-3,6-dimethylidene-2-oxo-7,7a-dihydro-3aH-1-benzofuran-5-yl]pentyl] acetate (PubChem CID 164613149) has the molecular formula C17H22O4 and a molecular weight of 290.36 g/mol. Its IUPAC name is [(4S)-4-[(3aR,7aR)-3,6-dimethylidene-2-oxo-7,7a-dihydro-3aH-1-benzofuran-5-yl]pentyl] acetate.
| Compound Name | [(4S)-4-[(3aR,7aR)-3,6-dimethylidene-2-oxo-7,7a-dihydro-3aH-1-benzofuran-5-yl]pentyl] acetate |
|---|---|
| PubChem CID | 164613149 |
| Molecular Formula | C17H22O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | [(4S)-4-[(3aR,7aR)-3,6-dimethylidene-2-oxo-7,7a-dihydro-3aH-1-benzofuran-5-yl]pentyl] acetate |
| SMILES | C=C1C[C@H]2OC(=O)C(=C)[C@H]2C=C1[C@@H](C)CCCOC(C)=O |
| InChI | InChI=1S/C17H22O4/c1-10(6-5-7-20-13(4)18)14-9-15-12(3)17(19)21-16(15)8-11(14)2/h9-10,15-16H,2-3,5-8H2,1,4H3/t10-,15+,16+/m0/s1 |
| InChIKey | GEELTMUQQHJAJE-AMKSKSKJSA-N |
| XLogP | 2.95 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|