C16H28N2O4 — CID 164613373
(2R)-N-[(5-hexyl-1,2-oxazol-3-yl)methyl]-2,4-dihydroxy-3,3-dimethylbutanamide (PubChem CID 164613373) has the molecular formula C16H28N2O4 and a molecular weight of 312.41 g/mol. Its IUPAC name is (2R)-N-[(5-hexyl-1,2-oxazol-3-yl)methyl]-2,4-dihydroxy-3,3-dimethylbutanamide.
| Compound Name | (2R)-N-[(5-hexyl-1,2-oxazol-3-yl)methyl]-2,4-dihydroxy-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 164613373 |
| Molecular Formula | C16H28N2O4 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | (2R)-N-[(5-hexyl-1,2-oxazol-3-yl)methyl]-2,4-dihydroxy-3,3-dimethylbutanamide |
| SMILES | CCCCCCc1cc(CNC(=O)[C@H](O)C(C)(C)CO)no1 |
| InChI | InChI=1S/C16H28N2O4/c1-4-5-6-7-8-13-9-12(18-22-13)10-17-15(21)14(20)16(2,3)11-19/h9,14,19-20H,4-8,10-11H2,1-3H3,(H,17,21)/t14-/m0/s1 |
| InChIKey | NACDIUBZQXWWMG-AWEZNQCLSA-N |
| XLogP | 1.79 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|