C25H29N3O4 — CID 164613469
N-[4-[(4aR,10bR)-9-methoxy-3,4a,5,10b-tetrahydro-2H-chromeno[4,3-b][1,4]oxazin-4-yl]butyl]-1H-indole-2-carboxamide (PubChem CID 164613469) has the molecular formula C25H29N3O4 and a molecular weight of 435.52 g/mol. Its IUPAC name is N-[4-[(4aR,10bR)-9-methoxy-3,4a,5,10b-tetrahydro-2H-chromeno[4,3-b][1,4]oxazin-4-yl]butyl]-1H-indole-2-carboxamide.
| Compound Name | N-[4-[(4aR,10bR)-9-methoxy-3,4a,5,10b-tetrahydro-2H-chromeno[4,3-b][1,4]oxazin-4-yl]butyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 164613469 |
| Molecular Formula | C25H29N3O4 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | N-[4-[(4aR,10bR)-9-methoxy-3,4a,5,10b-tetrahydro-2H-chromeno[4,3-b][1,4]oxazin-4-yl]butyl]-1H-indole-2-carboxamide |
| SMILES | COc1ccc2c(c1)[C@H]1OCCN(CCCCNC(=O)c3cc4ccccc4[nH]3)[C@@H]1CO2 |
| InChI | InChI=1S/C25H29N3O4/c1-30-18-8-9-23-19(15-18)24-22(16-32-23)28(12-13-31-24)11-5-4-10-26-25(29)21-14-17-6-2-3-7-20(17)27-21/h2-3,6-9,14-15,22,24,27H,4-5,10-13,16H2,1H3,(H,26,29)/t22-,24-/m1/s1 |
| InChIKey | IGUDRQBHUOBFPO-ISKFKSNPSA-N |
| XLogP | 3.52 |
| TPSA | 75.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|