C24H23N7O3S — CID 164613510
2-[1-ethylsulfonyl-3-[4-[4-(5-methylfuran-2-yl)-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]pyrazol-1-yl]azetidin-3-yl]acetonitrile (PubChem CID 164613510) has the molecular formula C24H23N7O3S and a molecular weight of 489.56 g/mol. Its IUPAC name is 2-[1-ethylsulfonyl-3-[4-[4-(5-methylfuran-2-yl)-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]pyrazol-1-yl]azetidin-3-yl]acetonitrile.
| Compound Name | 2-[1-ethylsulfonyl-3-[4-[4-(5-methylfuran-2-yl)-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]pyrazol-1-yl]azetidin-3-yl]acetonitrile |
|---|---|
| PubChem CID | 164613510 |
| Molecular Formula | C24H23N7O3S |
| Molecular Weight | 489.56 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | 2-[1-ethylsulfonyl-3-[4-[4-(5-methylfuran-2-yl)-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]pyrazol-1-yl]azetidin-3-yl]acetonitrile |
| SMILES | CCS(=O)(=O)N1CC(CC#N)(n2cc(-n3c(-c4ccc(C)o4)cc4cnc5[nH]ccc5c43)cn2)C1 |
| InChI | InChI=1S/C24H23N7O3S/c1-3-35(32,33)29-14-24(15-29,7-8-25)30-13-18(12-28-30)31-20(21-5-4-16(2)34-21)10-17-11-27-23-19(22(17)31)6-9-26-23/h4-6,9-13H,3,7,14-15H2,1-2H3,(H,26,27) |
| InChIKey | PDIQRKQRVCXOTR-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 125.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.56 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |