C15H15N5O2S — CID 164613714
2-[[5-(2-methylimidazo[2,1-b][1,3]benzothiazol-1-yl)-1,3,4-oxadiazol-2-yl]methylamino]ethanol (PubChem CID 164613714) has the molecular formula C15H15N5O2S and a molecular weight of 329.39 g/mol. Its IUPAC name is 2-[[5-(2-methylimidazo[2,1-b][1,3]benzothiazol-1-yl)-1,3,4-oxadiazol-2-yl]methylamino]ethanol.
| Compound Name | 2-[[5-(2-methylimidazo[2,1-b][1,3]benzothiazol-1-yl)-1,3,4-oxadiazol-2-yl]methylamino]ethanol |
|---|---|
| PubChem CID | 164613714 |
| Molecular Formula | C15H15N5O2S |
| Molecular Weight | 329.39 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 2-[[5-(2-methylimidazo[2,1-b][1,3]benzothiazol-1-yl)-1,3,4-oxadiazol-2-yl]methylamino]ethanol |
| SMILES | Cc1nc2sc3ccccc3n2c1-c1nnc(CNCCO)o1 |
| InChI | InChI=1S/C15H15N5O2S/c1-9-13(14-19-18-12(22-14)8-16-6-7-21)20-10-4-2-3-5-11(10)23-15(20)17-9/h2-5,16,21H,6-8H2,1H3 |
| InChIKey | XCDRHDYPSBDDMV-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.39 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|