C20H30O2 — CID 164613726
(1S,3R,5R,8R,10R,13S)-1,5,10-trimethyl-14-prop-1-en-2-yl-4,9-dioxatetracyclo[11.3.0.03,5.08,10]hexadec-14-ene (PubChem CID 164613726) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is (1S,3R,5R,8R,10R,13S)-1,5,10-trimethyl-14-prop-1-en-2-yl-4,9-dioxatetracyclo[11.3.0.03,5.08,10]hexadec-14-ene.
| Compound Name | (1S,3R,5R,8R,10R,13S)-1,5,10-trimethyl-14-prop-1-en-2-yl-4,9-dioxatetracyclo[11.3.0.03,5.08,10]hexadec-14-ene |
|---|---|
| PubChem CID | 164613726 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | (1S,3R,5R,8R,10R,13S)-1,5,10-trimethyl-14-prop-1-en-2-yl-4,9-dioxatetracyclo[11.3.0.03,5.08,10]hexadec-14-ene |
| SMILES | C=C(C)C1=CC[C@@]2(C)C[C@H]3O[C@]3(C)CC[C@H]3O[C@]3(C)CC[C@H]12 |
| InChI | InChI=1S/C20H30O2/c1-13(2)14-6-9-18(3)12-17-20(5,22-17)11-8-16-19(4,21-16)10-7-15(14)18/h6,15-17H,1,7-12H2,2-5H3/t15-,16-,17-,18+,19-,20-/m1/s1 |
| InChIKey | YMLXMTHJCDTXAS-IGOIZDSHSA-N |
| XLogP | 4.79 |
| TPSA | 25.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|