About 4-chloro-6-(4-chlorophenyl)-N-[4-(trifluoromethoxy)phenyl]-1,3,5-triazin-2-amine
4-chloro-6-(4-chlorophenyl)-N-[4-(trifluoromethoxy)phenyl]-1,3,5-triazin-2-amine (PubChem CID 164613880) has the molecular formula C16H9Cl2F3N4O
and a molecular weight of 401.18 g/mol. Its IUPAC name is 4-chloro-6-(4-chlorophenyl)-N-[4-(trifluoromethoxy)phenyl]-1,3,5-triazin-2-amine.
Molecular Properties
| Compound Name | 4-chloro-6-(4-chlorophenyl)-N-[4-(trifluoromethoxy)phenyl]-1,3,5-triazin-2-amine |
| PubChem CID | 164613880 |
| Molecular Formula | C16H9Cl2F3N4O |
| Molecular Weight | 401.18 g/mol |
| Exact Mass | 400.01 |
| IUPAC Name | 4-chloro-6-(4-chlorophenyl)-N-[4-(trifluoromethoxy)phenyl]-1,3,5-triazin-2-amine |
| SMILES | FC(F)(F)Oc1ccc(Nc2nc(Cl)nc(-c3ccc(Cl)cc3)n2)cc1 |
| InChI | InChI=1S/C16H9Cl2F3N4O/c17-10-3-1-9(2-4-10)13-23-14(18)25-15(24-13)22-11-5-7-12(8-6-11)26-16(19,20)21/h1-8H,(H,22,23,24,25) |
| InChIKey | YPKJDXKTEWTKIY-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.18 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-chloro-6-(4-chlorophenyl)-N-[4-(trifluoromethoxy)phenyl]-1,3,5-triazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-6-(4-chlorophenyl)-N-[4-(trifluoromethoxy)phenyl]-1,3,5-triazin-2-amine?
The IUPAC name of 4-chloro-6-(4-chlorophenyl)-N-[4-(trifluoromethoxy)phenyl]-1,3,5-triazin-2-amine (CID 164613880) is 4-chloro-6-(4-chlorophenyl)-N-[4-(trifluoromethoxy)phenyl]-1,3,5-triazin-2-amine.
What is the SMILES notation for 4-chloro-6-(4-chlorophenyl)-N-[4-(trifluoromethoxy)phenyl]-1,3,5-triazin-2-amine?
The canonical SMILES for 4-chloro-6-(4-chlorophenyl)-N-[4-(trifluoromethoxy)phenyl]-1,3,5-triazin-2-amine is FC(F)(F)Oc1ccc(Nc2nc(Cl)nc(-c3ccc(Cl)cc3)n2)cc1.
What is the InChIKey of 4-chloro-6-(4-chlorophenyl)-N-[4-(trifluoromethoxy)phenyl]-1,3,5-triazin-2-amine?
The InChIKey is YPKJDXKTEWTKIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H9Cl2F3N4O/c17-10-3-1-9(2-4-10)13-23-14(18)25-15(24-13)22-11-5-7-12(8-6-11)26-16(19,20)21/h1-8H,(H,22,23,24,25).
What are the key properties of 4-chloro-6-(4-chlorophenyl)-N-[4-(trifluoromethoxy)phenyl]-1,3,5-triazin-2-amine?
4-chloro-6-(4-chlorophenyl)-N-[4-(trifluoromethoxy)phenyl]-1,3,5-triazin-2-amine has a molecular weight of 401.18 g/mol, XLogP of 5.49, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-6-(4-chlorophenyl)-N-[4-(trifluoromethoxy)phenyl]-1,3,5-triazin-2-amine is sourced from PubChem (CID 164613880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).