C31H46N2O3 — CID 164613986
(1R,2S,5S,10S,14R,15R,22S,23R)-22-(hydroxymethyl)-1,2,8,8,15,22-hexamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-triene-5-carboxylic acid (PubChem CID 164613986) has the molecular formula C31H46N2O3 and a molecular weight of 494.72 g/mol. Its IUPAC name is (1R,2S,5S,10S,14R,15R,22S,23R)-22-(hydroxymethyl)-1,2,8,8,15,22-hexamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-triene-5-carboxylic acid.
| Compound Name | (1R,2S,5S,10S,14R,15R,22S,23R)-22-(hydroxymethyl)-1,2,8,8,15,22-hexamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-triene-5-carboxylic acid |
|---|---|
| PubChem CID | 164613986 |
| Molecular Formula | C31H46N2O3 |
| Molecular Weight | 494.72 g/mol |
| Exact Mass | 494.35 |
| IUPAC Name | (1R,2S,5S,10S,14R,15R,22S,23R)-22-(hydroxymethyl)-1,2,8,8,15,22-hexamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-triene-5-carboxylic acid |
| SMILES | CC1(C)CC[C@]2(C(=O)O)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)Cc6cn[nH]c6[C@@](C)(CO)[C@@H]5CC[C@]43C)[C@@H]2C1 |
| InChI | InChI=1S/C31H46N2O3/c1-26(2)11-13-31(25(35)36)14-12-29(5)20(21(31)16-26)7-8-23-27(3)15-19-17-32-33-24(19)28(4,18-34)22(27)9-10-30(23,29)6/h7,17,21-23,34H,8-16,18H2,1-6H3,(H,32,33)(H,35,36)/t21-,22+,23+,27-,28-,29+,30+,31-/m0/s1 |
| InChIKey | GOVAXKRHZHZEQT-CYFLCHJQSA-N |
| XLogP | 6.28 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.72 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|