C28H26F6N2O5S — CID 164614077
N-[4-[2-[6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3-dihydro-1,4-benzoxazin-4-yl]ethyl]phenyl]-2-(4-methylsulfonylphenyl)acetamide (PubChem CID 164614077) has the molecular formula C28H26F6N2O5S and a molecular weight of 616.58 g/mol. Its IUPAC name is N-[4-[2-[6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3-dihydro-1,4-benzoxazin-4-yl]ethyl]phenyl]-2-(4-methylsulfonylphenyl)acetamide.
| Compound Name | N-[4-[2-[6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3-dihydro-1,4-benzoxazin-4-yl]ethyl]phenyl]-2-(4-methylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 164614077 |
| Molecular Formula | C28H26F6N2O5S |
| Molecular Weight | 616.58 g/mol |
| Exact Mass | 616.15 |
| IUPAC Name | N-[4-[2-[6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3-dihydro-1,4-benzoxazin-4-yl]ethyl]phenyl]-2-(4-methylsulfonylphenyl)acetamide |
| SMILES | CS(=O)(=O)c1ccc(CC(=O)Nc2ccc(CCN3CCOc4ccc(C(O)(C(F)(F)F)C(F)(F)F)cc43)cc2)cc1 |
| InChI | InChI=1S/C28H26F6N2O5S/c1-42(39,40)22-9-4-19(5-10-22)16-25(37)35-21-7-2-18(3-8-21)12-13-36-14-15-41-24-11-6-20(17-23(24)36)26(38,27(29,30)31)28(32,33)34/h2-11,17,38H,12-16H2,1H3,(H,35,37) |
| InChIKey | LBCOINBUSJSPOF-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.58 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |