C31H56N3O3+ — CID 164614114
3-(hexanoylamino)propyl-dimethyl-[(8-methyl-2-undecan-2-yl-4H-[1,3]dioxino[4,5-c]pyridin-5-yl)methyl]azanium (PubChem CID 164614114) has the molecular formula C31H56N3O3+ and a molecular weight of 518.81 g/mol. Its IUPAC name is 3-(hexanoylamino)propyl-dimethyl-[(8-methyl-2-undecan-2-yl-4H-[1,3]dioxino[4,5-c]pyridin-5-yl)methyl]azanium.
| Compound Name | 3-(hexanoylamino)propyl-dimethyl-[(8-methyl-2-undecan-2-yl-4H-[1,3]dioxino[4,5-c]pyridin-5-yl)methyl]azanium |
|---|---|
| PubChem CID | 164614114 |
| Molecular Formula | C31H56N3O3+ |
| Molecular Weight | 518.81 g/mol |
| Exact Mass | 518.43 |
| IUPAC Name | 3-(hexanoylamino)propyl-dimethyl-[(8-methyl-2-undecan-2-yl-4H-[1,3]dioxino[4,5-c]pyridin-5-yl)methyl]azanium |
| SMILES | CCCCCCCCCC(C)C1OCc2c(C[N+](C)(C)CCCNC(=O)CCCCC)cnc(C)c2O1 |
| InChI | InChI=1S/C31H55N3O3/c1-7-9-11-12-13-14-16-18-25(3)31-36-24-28-27(22-33-26(4)30(28)37-31)23-34(5,6)21-17-20-32-29(35)19-15-10-8-2/h22,25,31H,7-21,23-24H2,1-6H3/p+1 |
| InChIKey | KPWAAFWCOLFIQZ-UHFFFAOYSA-O |
| XLogP | 7.06 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.81 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|