C15H24O3 — CID 164614175
(6E,8S,10S)-8,10-dihydroxy-2,6,10-trimethyldodeca-2,6,11-trien-4-one (PubChem CID 164614175) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is (6E,8S,10S)-8,10-dihydroxy-2,6,10-trimethyldodeca-2,6,11-trien-4-one.
| Compound Name | (6E,8S,10S)-8,10-dihydroxy-2,6,10-trimethyldodeca-2,6,11-trien-4-one |
|---|---|
| PubChem CID | 164614175 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | (6E,8S,10S)-8,10-dihydroxy-2,6,10-trimethyldodeca-2,6,11-trien-4-one |
| SMILES | C=C[C@@](C)(O)C[C@H](O)/C=C(\C)CC(=O)C=C(C)C |
| InChI | InChI=1S/C15H24O3/c1-6-15(5,18)10-14(17)9-12(4)8-13(16)7-11(2)3/h6-7,9,14,17-18H,1,8,10H2,2-5H3/b12-9+/t14-,15-/m1/s1 |
| InChIKey | QUHAGGBURLHHIO-PRYPJVTBSA-N |
| XLogP | 2.55 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|