C19H22N6O4S2 — CID 164614204
ethyl 7-methyl-3-[2-(4-sulfamoylphenyl)ethylcarbamothioylamino]pyrazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 164614204) has the molecular formula C19H22N6O4S2 and a molecular weight of 462.56 g/mol. Its IUPAC name is ethyl 7-methyl-3-[2-(4-sulfamoylphenyl)ethylcarbamothioylamino]pyrazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl 7-methyl-3-[2-(4-sulfamoylphenyl)ethylcarbamothioylamino]pyrazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 164614204 |
| Molecular Formula | C19H22N6O4S2 |
| Molecular Weight | 462.56 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | ethyl 7-methyl-3-[2-(4-sulfamoylphenyl)ethylcarbamothioylamino]pyrazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)c1cnc2c(NC(=S)NCCc3ccc(S(N)(=O)=O)cc3)cnn2c1C |
| InChI | InChI=1S/C19H22N6O4S2/c1-3-29-18(26)15-10-22-17-16(11-23-25(17)12(15)2)24-19(30)21-9-8-13-4-6-14(7-5-13)31(20,27)28/h4-7,10-11H,3,8-9H2,1-2H3,(H2,20,27,28)(H2,21,24,30) |
| InChIKey | QOZYPMLIFHCTDK-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 140.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.56 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|