C25H38O6 — CID 164614221
[(3aS,5R,5aS,6S,8R,8aS,9aR)-5,8a-dimethyl-8-(3-methylbutanoyloxy)-1-methylidene-2-oxo-4,5,5a,6,7,8,9,9a-octahydro-3aH-azuleno[6,5-b]furan-6-yl] 3-methylbutanoate (PubChem CID 164614221) has the molecular formula C25H38O6 and a molecular weight of 434.57 g/mol. Its IUPAC name is [(3aS,5R,5aS,6S,8R,8aS,9aR)-5,8a-dimethyl-8-(3-methylbutanoyloxy)-1-methylidene-2-oxo-4,5,5a,6,7,8,9,9a-octahydro-3aH-azuleno[6,5-b]furan-6-yl] 3-methylbutanoate.
| Compound Name | [(3aS,5R,5aS,6S,8R,8aS,9aR)-5,8a-dimethyl-8-(3-methylbutanoyloxy)-1-methylidene-2-oxo-4,5,5a,6,7,8,9,9a-octahydro-3aH-azuleno[6,5-b]furan-6-yl] 3-methylbutanoate |
|---|---|
| PubChem CID | 164614221 |
| Molecular Formula | C25H38O6 |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | [(3aS,5R,5aS,6S,8R,8aS,9aR)-5,8a-dimethyl-8-(3-methylbutanoyloxy)-1-methylidene-2-oxo-4,5,5a,6,7,8,9,9a-octahydro-3aH-azuleno[6,5-b]furan-6-yl] 3-methylbutanoate |
| SMILES | C=C1C(=O)O[C@H]2C[C@@H](C)[C@@H]3[C@@H](OC(=O)CC(C)C)C[C@@H](OC(=O)CC(C)C)[C@@]3(C)C[C@H]12 |
| InChI | InChI=1S/C25H38O6/c1-13(2)8-21(26)29-19-11-20(31-22(27)9-14(3)4)25(7)12-17-16(6)24(28)30-18(17)10-15(5)23(19)25/h13-15,17-20,23H,6,8-12H2,1-5,7H3/t15-,17-,18+,19+,20-,23-,25-/m1/s1 |
| InChIKey | FQBCFRGCCVYNRG-PCNWWEGESA-N |
| XLogP | 4.46 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|