C27H34N6O3 — CID 164614270
3-[2-[7-(diethylamino)-4-methyl-2-oxochromen-3-yl]ethyl]-8-pyrimidin-2-yl-1,3,8-triazaspiro[4.5]decan-2-one (PubChem CID 164614270) has the molecular formula C27H34N6O3 and a molecular weight of 490.61 g/mol. Its IUPAC name is 3-[2-[7-(diethylamino)-4-methyl-2-oxochromen-3-yl]ethyl]-8-pyrimidin-2-yl-1,3,8-triazaspiro[4.5]decan-2-one.
| Compound Name | 3-[2-[7-(diethylamino)-4-methyl-2-oxochromen-3-yl]ethyl]-8-pyrimidin-2-yl-1,3,8-triazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 164614270 |
| Molecular Formula | C27H34N6O3 |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.27 |
| IUPAC Name | 3-[2-[7-(diethylamino)-4-methyl-2-oxochromen-3-yl]ethyl]-8-pyrimidin-2-yl-1,3,8-triazaspiro[4.5]decan-2-one |
| SMILES | CCN(CC)c1ccc2c(C)c(CCN3CC4(CCN(c5ncccn5)CC4)NC3=O)c(=O)oc2c1 |
| InChI | InChI=1S/C27H34N6O3/c1-4-31(5-2)20-7-8-21-19(3)22(24(34)36-23(21)17-20)9-14-33-18-27(30-26(33)35)10-15-32(16-11-27)25-28-12-6-13-29-25/h6-8,12-13,17H,4-5,9-11,14-16,18H2,1-3H3,(H,30,35) |
| InChIKey | KOEPIKQODATHPU-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 94.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|