About 2,6-diphenyl-3-phenylsulfanylimidazo[1,2-a]pyridine
2,6-diphenyl-3-phenylsulfanylimidazo[1,2-a]pyridine (PubChem CID 164614327) has the molecular formula C25H18N2S
and a molecular weight of 378.50 g/mol. Its IUPAC name is 2,6-diphenyl-3-phenylsulfanylimidazo[1,2-a]pyridine.
Molecular Properties
| Compound Name | 2,6-diphenyl-3-phenylsulfanylimidazo[1,2-a]pyridine |
| PubChem CID | 164614327 |
| Molecular Formula | C25H18N2S |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 2,6-diphenyl-3-phenylsulfanylimidazo[1,2-a]pyridine |
| SMILES | c1ccc(Sc2c(-c3ccccc3)nc3ccc(-c4ccccc4)cn23)cc1 |
| InChI | InChI=1S/C25H18N2S/c1-4-10-19(11-5-1)21-16-17-23-26-24(20-12-6-2-7-13-20)25(27(23)18-21)28-22-14-8-3-9-15-22/h1-18H |
| InChIKey | IMLVJAARZMYPAV-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,6-diphenyl-3-phenylsulfanylimidazo[1,2-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-diphenyl-3-phenylsulfanylimidazo[1,2-a]pyridine?
The IUPAC name of 2,6-diphenyl-3-phenylsulfanylimidazo[1,2-a]pyridine (CID 164614327) is 2,6-diphenyl-3-phenylsulfanylimidazo[1,2-a]pyridine.
What is the SMILES notation for 2,6-diphenyl-3-phenylsulfanylimidazo[1,2-a]pyridine?
The canonical SMILES for 2,6-diphenyl-3-phenylsulfanylimidazo[1,2-a]pyridine is c1ccc(Sc2c(-c3ccccc3)nc3ccc(-c4ccccc4)cn23)cc1.
What is the InChIKey of 2,6-diphenyl-3-phenylsulfanylimidazo[1,2-a]pyridine?
The InChIKey is IMLVJAARZMYPAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H18N2S/c1-4-10-19(11-5-1)21-16-17-23-26-24(20-12-6-2-7-13-20)25(27(23)18-21)28-22-14-8-3-9-15-22/h1-18H.
What are the key properties of 2,6-diphenyl-3-phenylsulfanylimidazo[1,2-a]pyridine?
2,6-diphenyl-3-phenylsulfanylimidazo[1,2-a]pyridine has a molecular weight of 378.50 g/mol, XLogP of 6.82, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-diphenyl-3-phenylsulfanylimidazo[1,2-a]pyridine is sourced from PubChem (CID 164614327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).