About N-benzyl-2-[(2S,6R)-6-phenyloxan-2-yl]ethanamine
N-benzyl-2-[(2S,6R)-6-phenyloxan-2-yl]ethanamine (PubChem CID 164614355) has the molecular formula C20H25NO
and a molecular weight of 295.43 g/mol. Its IUPAC name is N-benzyl-2-[(2S,6R)-6-phenyloxan-2-yl]ethanamine.
Molecular Properties
| Compound Name | N-benzyl-2-[(2S,6R)-6-phenyloxan-2-yl]ethanamine |
| PubChem CID | 164614355 |
| Molecular Formula | C20H25NO |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | N-benzyl-2-[(2S,6R)-6-phenyloxan-2-yl]ethanamine |
| SMILES | c1ccc(CNCC[C@@H]2CCC[C@H](c3ccccc3)O2)cc1 |
| InChI | InChI=1S/C20H25NO/c1-3-8-17(9-4-1)16-21-15-14-19-12-7-13-20(22-19)18-10-5-2-6-11-18/h1-6,8-11,19-21H,7,12-16H2/t19-,20+/m0/s1 |
| InChIKey | KCBHKHSZASKQOF-VQTJNVASSA-N |
| XLogP | 4.48 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-2-[(2S,6R)-6-phenyloxan-2-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-2-[(2S,6R)-6-phenyloxan-2-yl]ethanamine?
The IUPAC name of N-benzyl-2-[(2S,6R)-6-phenyloxan-2-yl]ethanamine (CID 164614355) is N-benzyl-2-[(2S,6R)-6-phenyloxan-2-yl]ethanamine.
What is the SMILES notation for N-benzyl-2-[(2S,6R)-6-phenyloxan-2-yl]ethanamine?
The canonical SMILES for N-benzyl-2-[(2S,6R)-6-phenyloxan-2-yl]ethanamine is c1ccc(CNCC[C@@H]2CCC[C@H](c3ccccc3)O2)cc1.
What is the InChIKey of N-benzyl-2-[(2S,6R)-6-phenyloxan-2-yl]ethanamine?
The InChIKey is KCBHKHSZASKQOF-VQTJNVASSA-N. The full InChI is InChI=1S/C20H25NO/c1-3-8-17(9-4-1)16-21-15-14-19-12-7-13-20(22-19)18-10-5-2-6-11-18/h1-6,8-11,19-21H,7,12-16H2/t19-,20+/m0/s1.
What are the key properties of N-benzyl-2-[(2S,6R)-6-phenyloxan-2-yl]ethanamine?
N-benzyl-2-[(2S,6R)-6-phenyloxan-2-yl]ethanamine has a molecular weight of 295.43 g/mol, XLogP of 4.48, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-2-[(2S,6R)-6-phenyloxan-2-yl]ethanamine is sourced from PubChem (CID 164614355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).