C27H27F3N2O2 — CID 164614432
(1S)-1-[(4aR,5S)-1-(4-fluorophenyl)-4a-methyl-5,6,7,8-tetrahydro-4H-benzo[f]indazol-5-yl]-1-(3,4-difluoro-5-methoxyphenyl)ethanol (PubChem CID 164614432) has the molecular formula C27H27F3N2O2 and a molecular weight of 468.52 g/mol. Its IUPAC name is (1S)-1-[(4aR,5S)-1-(4-fluorophenyl)-4a-methyl-5,6,7,8-tetrahydro-4H-benzo[f]indazol-5-yl]-1-(3,4-difluoro-5-methoxyphenyl)ethanol.
| Compound Name | (1S)-1-[(4aR,5S)-1-(4-fluorophenyl)-4a-methyl-5,6,7,8-tetrahydro-4H-benzo[f]indazol-5-yl]-1-(3,4-difluoro-5-methoxyphenyl)ethanol |
|---|---|
| PubChem CID | 164614432 |
| Molecular Formula | C27H27F3N2O2 |
| Molecular Weight | 468.52 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | (1S)-1-[(4aR,5S)-1-(4-fluorophenyl)-4a-methyl-5,6,7,8-tetrahydro-4H-benzo[f]indazol-5-yl]-1-(3,4-difluoro-5-methoxyphenyl)ethanol |
| SMILES | COc1cc([C@@](C)(O)[C@H]2CCCC3=Cc4c(cnn4-c4ccc(F)cc4)C[C@@]32C)cc(F)c1F |
| InChI | InChI=1S/C27H27F3N2O2/c1-26-14-16-15-31-32(20-9-7-19(28)8-10-20)22(16)12-17(26)5-4-6-24(26)27(2,33)18-11-21(29)25(30)23(13-18)34-3/h7-13,15,24,33H,4-6,14H2,1-3H3/t24-,26-,27+/m0/s1 |
| InChIKey | XNMYFBXYVIUDKT-DOEKTCAHSA-N |
| XLogP | 5.95 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.52 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |