C17H13N5O2 — CID 164614441
N-(6-methoxy-3-pyridinyl)-1,6,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8,10,12-hexaene-11-carboxamide (PubChem CID 164614441) has the molecular formula C17H13N5O2 and a molecular weight of 319.32 g/mol. Its IUPAC name is N-(6-methoxy-3-pyridinyl)-1,6,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8,10,12-hexaene-11-carboxamide.
| Compound Name | N-(6-methoxy-3-pyridinyl)-1,6,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8,10,12-hexaene-11-carboxamide |
|---|---|
| PubChem CID | 164614441 |
| Molecular Formula | C17H13N5O2 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | N-(6-methoxy-3-pyridinyl)-1,6,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8,10,12-hexaene-11-carboxamide |
| SMILES | COc1ccc(NC(=O)c2ccn3c(c2)nc2ncccc23)cn1 |
| InChI | InChI=1S/C17H13N5O2/c1-24-15-5-4-12(10-19-15)20-17(23)11-6-8-22-13-3-2-7-18-16(13)21-14(22)9-11/h2-10H,1H3,(H,20,23) |
| InChIKey | CKTNOPGMIPJJGX-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |