About 1-[N'-[3-(2-amino-4-methyl-1,3-thiazol-5-yl)propyl]carbamimidoyl]-3-hexylurea
1-[N'-[3-(2-amino-4-methyl-1,3-thiazol-5-yl)propyl]carbamimidoyl]-3-hexylurea (PubChem CID 164614549) has the molecular formula C15H28N6OS
and a molecular weight of 340.50 g/mol. Its IUPAC name is 1-[N'-[3-(2-amino-4-methyl-1,3-thiazol-5-yl)propyl]carbamimidoyl]-3-hexylurea.
Molecular Properties
| Compound Name | 1-[N'-[3-(2-amino-4-methyl-1,3-thiazol-5-yl)propyl]carbamimidoyl]-3-hexylurea |
| PubChem CID | 164614549 |
| Molecular Formula | C15H28N6OS |
| Molecular Weight | 340.50 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | 1-[N'-[3-(2-amino-4-methyl-1,3-thiazol-5-yl)propyl]carbamimidoyl]-3-hexylurea |
| SMILES | CCCCCCNC(=O)N/C(N)=N/CCCc1sc(N)nc1C |
| InChI | InChI=1S/C15H28N6OS/c1-3-4-5-6-9-19-15(22)21-13(16)18-10-7-8-12-11(2)20-14(17)23-12/h3-10H2,1-2H3,(H2,17,20)(H4,16,18,19,21,22) |
| InChIKey | CKIPXVNSJRXNTQ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 118.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.50 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[N'-[3-(2-amino-4-methyl-1,3-thiazol-5-yl)propyl]carbamimidoyl]-3-hexylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[N'-[3-(2-amino-4-methyl-1,3-thiazol-5-yl)propyl]carbamimidoyl]-3-hexylurea?
The IUPAC name of 1-[N'-[3-(2-amino-4-methyl-1,3-thiazol-5-yl)propyl]carbamimidoyl]-3-hexylurea (CID 164614549) is 1-[N'-[3-(2-amino-4-methyl-1,3-thiazol-5-yl)propyl]carbamimidoyl]-3-hexylurea.
What is the SMILES notation for 1-[N'-[3-(2-amino-4-methyl-1,3-thiazol-5-yl)propyl]carbamimidoyl]-3-hexylurea?
The canonical SMILES for 1-[N'-[3-(2-amino-4-methyl-1,3-thiazol-5-yl)propyl]carbamimidoyl]-3-hexylurea is CCCCCCNC(=O)N/C(N)=N/CCCc1sc(N)nc1C.
What is the InChIKey of 1-[N'-[3-(2-amino-4-methyl-1,3-thiazol-5-yl)propyl]carbamimidoyl]-3-hexylurea?
The InChIKey is CKIPXVNSJRXNTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28N6OS/c1-3-4-5-6-9-19-15(22)21-13(16)18-10-7-8-12-11(2)20-14(17)23-12/h3-10H2,1-2H3,(H2,17,20)(H4,16,18,19,21,22).
What are the key properties of 1-[N'-[3-(2-amino-4-methyl-1,3-thiazol-5-yl)propyl]carbamimidoyl]-3-hexylurea?
1-[N'-[3-(2-amino-4-methyl-1,3-thiazol-5-yl)propyl]carbamimidoyl]-3-hexylurea has a molecular weight of 340.50 g/mol, XLogP of 2.16, 9 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[N'-[3-(2-amino-4-methyl-1,3-thiazol-5-yl)propyl]carbamimidoyl]-3-hexylurea is sourced from PubChem (CID 164614549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).