C34H45N5O2 — CID 164614567
(3S,6S,22E)-6-(6-oxooctyl)-5,8,20,25,31-pentazaheptacyclo[23.2.2.17,10.111,15.01,3.014,19.016,20]hentriaconta-7,9,11(30),12,14,22-hexaen-4-one (PubChem CID 164614567) has the molecular formula C34H45N5O2 and a molecular weight of 555.77 g/mol. Its IUPAC name is (3S,6S,22E)-6-(6-oxooctyl)-5,8,20,25,31-pentazaheptacyclo[23.2.2.17,10.111,15.01,3.014,19.016,20]hentriaconta-7,9,11(30),12,14,22-hexaen-4-one.
| Compound Name | (3S,6S,22E)-6-(6-oxooctyl)-5,8,20,25,31-pentazaheptacyclo[23.2.2.17,10.111,15.01,3.014,19.016,20]hentriaconta-7,9,11(30),12,14,22-hexaen-4-one |
|---|---|
| PubChem CID | 164614567 |
| Molecular Formula | C34H45N5O2 |
| Molecular Weight | 555.77 g/mol |
| Exact Mass | 555.36 |
| IUPAC Name | (3S,6S,22E)-6-(6-oxooctyl)-5,8,20,25,31-pentazaheptacyclo[23.2.2.17,10.111,15.01,3.014,19.016,20]hentriaconta-7,9,11(30),12,14,22-hexaen-4-one |
| SMILES | CCC(=O)CCCCC[C@@H]1NC(=O)[C@H]2CC23CCN(C/C=C/CN2C4CCC2c2cc(ccc24)-c2cnc1[nH]2)CC3 |
| InChI | InChI=1S/C34H45N5O2/c1-2-24(40)8-4-3-5-9-28-32-35-22-29(36-32)23-10-11-25-26(20-23)31-13-12-30(25)39(31)17-7-6-16-38-18-14-34(15-19-38)21-27(34)33(41)37-28/h6-7,10-11,20,22,27-28,30-31H,2-5,8-9,12-19,21H2,1H3,(H,35,36)(H,37,41)/b7-6+/t27-,28+,30?,31?/m1/s1 |
| InChIKey | WBDNRODMXIVRIW-ANAIMFLESA-N |
| XLogP | 6.03 |
| TPSA | 81.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.77 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|