About N-[3-(azepan-1-yl)propyl]-4-methyl-5-phenyl-1,3-thiazole-2-carboxamide
N-[3-(azepan-1-yl)propyl]-4-methyl-5-phenyl-1,3-thiazole-2-carboxamide (PubChem CID 164614618) has the molecular formula C20H27N3OS
and a molecular weight of 357.52 g/mol. Its IUPAC name is N-[3-(azepan-1-yl)propyl]-4-methyl-5-phenyl-1,3-thiazole-2-carboxamide.
Molecular Properties
| Compound Name | N-[3-(azepan-1-yl)propyl]-4-methyl-5-phenyl-1,3-thiazole-2-carboxamide |
| PubChem CID | 164614618 |
| Molecular Formula | C20H27N3OS |
| Molecular Weight | 357.52 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | N-[3-(azepan-1-yl)propyl]-4-methyl-5-phenyl-1,3-thiazole-2-carboxamide |
| SMILES | Cc1nc(C(=O)NCCCN2CCCCCC2)sc1-c1ccccc1 |
| InChI | InChI=1S/C20H27N3OS/c1-16-18(17-10-5-4-6-11-17)25-20(22-16)19(24)21-12-9-15-23-13-7-2-3-8-14-23/h4-6,10-11H,2-3,7-9,12-15H2,1H3,(H,21,24) |
| InChIKey | XJNUBIWVBLKEST-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.52 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(azepan-1-yl)propyl]-4-methyl-5-phenyl-1,3-thiazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(azepan-1-yl)propyl]-4-methyl-5-phenyl-1,3-thiazole-2-carboxamide?
The IUPAC name of N-[3-(azepan-1-yl)propyl]-4-methyl-5-phenyl-1,3-thiazole-2-carboxamide (CID 164614618) is N-[3-(azepan-1-yl)propyl]-4-methyl-5-phenyl-1,3-thiazole-2-carboxamide.
What is the SMILES notation for N-[3-(azepan-1-yl)propyl]-4-methyl-5-phenyl-1,3-thiazole-2-carboxamide?
The canonical SMILES for N-[3-(azepan-1-yl)propyl]-4-methyl-5-phenyl-1,3-thiazole-2-carboxamide is Cc1nc(C(=O)NCCCN2CCCCCC2)sc1-c1ccccc1.
What is the InChIKey of N-[3-(azepan-1-yl)propyl]-4-methyl-5-phenyl-1,3-thiazole-2-carboxamide?
The InChIKey is XJNUBIWVBLKEST-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27N3OS/c1-16-18(17-10-5-4-6-11-17)25-20(22-16)19(24)21-12-9-15-23-13-7-2-3-8-14-23/h4-6,10-11H,2-3,7-9,12-15H2,1H3,(H,21,24).
What are the key properties of N-[3-(azepan-1-yl)propyl]-4-methyl-5-phenyl-1,3-thiazole-2-carboxamide?
N-[3-(azepan-1-yl)propyl]-4-methyl-5-phenyl-1,3-thiazole-2-carboxamide has a molecular weight of 357.52 g/mol, XLogP of 4.11, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(azepan-1-yl)propyl]-4-methyl-5-phenyl-1,3-thiazole-2-carboxamide is sourced from PubChem (CID 164614618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).