C22H20N2O6S — CID 164614668
2-(2,6-dioxopiperidin-3-yl)-4-(4-propan-2-ylphenyl)sulfonylisoindole-1,3-dione (PubChem CID 164614668) has the molecular formula C22H20N2O6S and a molecular weight of 440.48 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-(4-propan-2-ylphenyl)sulfonylisoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-(4-propan-2-ylphenyl)sulfonylisoindole-1,3-dione |
|---|---|
| PubChem CID | 164614668 |
| Molecular Formula | C22H20N2O6S |
| Molecular Weight | 440.48 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-(4-propan-2-ylphenyl)sulfonylisoindole-1,3-dione |
| SMILES | CC(C)c1ccc(S(=O)(=O)c2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)cc1 |
| InChI | InChI=1S/C22H20N2O6S/c1-12(2)13-6-8-14(9-7-13)31(29,30)17-5-3-4-15-19(17)22(28)24(21(15)27)16-10-11-18(25)23-20(16)26/h3-9,12,16H,10-11H2,1-2H3,(H,23,25,26) |
| InChIKey | FEFHPFRCEOXCDJ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.48 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|