C21H24F3N5O4 — CID 164614683
ethyl 5-phenyl-1-[1-[3-[(2,2,2-trifluoroacetyl)amino]propyl]triazole-4-carbonyl]pyrrolidine-2-carboxylate (PubChem CID 164614683) has the molecular formula C21H24F3N5O4 and a molecular weight of 467.45 g/mol. Its IUPAC name is ethyl 5-phenyl-1-[1-[3-[(2,2,2-trifluoroacetyl)amino]propyl]triazole-4-carbonyl]pyrrolidine-2-carboxylate.
| Compound Name | ethyl 5-phenyl-1-[1-[3-[(2,2,2-trifluoroacetyl)amino]propyl]triazole-4-carbonyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 164614683 |
| Molecular Formula | C21H24F3N5O4 |
| Molecular Weight | 467.45 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | ethyl 5-phenyl-1-[1-[3-[(2,2,2-trifluoroacetyl)amino]propyl]triazole-4-carbonyl]pyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)C1CCC(c2ccccc2)N1C(=O)c1cn(CCCNC(=O)C(F)(F)F)nn1 |
| InChI | InChI=1S/C21H24F3N5O4/c1-2-33-19(31)17-10-9-16(14-7-4-3-5-8-14)29(17)18(30)15-13-28(27-26-15)12-6-11-25-20(32)21(22,23)24/h3-5,7-8,13,16-17H,2,6,9-12H2,1H3,(H,25,32) |
| InChIKey | CDBJJPCFZVVCER-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.45 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|